cas: 1684443-00-2 — see every product listed under this CAS number, including other names
Potassium (1-(tert-butoxycarbonyl)pyrrolidin-2-yl)trifluoroborate, 98% (CAS 1684443-00-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F553453-250MG |
| cas | 1684443-00-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 825.77 Pln | |
| Fluorochem | 5g | 3101.01 Pln | |
| Fluorochem | 10g | 5704.26 Pln | |
| Fluorochem | 25g | 11217.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boranuide (CAS 1684443-00-2) is a chemical compound with the molecular formula C9H16BF3KNO2 and a molecular weight of 277.14 g/mol. IUPAC name: potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boranuide. InChIKey: JBFYSJLNBGRRCG-UHFFFAOYSA-N.
| Molecular formula | C9H16BF3KNO2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boranuide |
| InChIKey | JBFYSJLNBGRRCG-UHFFFAOYSA-N |
| SMILES | [B-](C1CCCN1C(=O)OC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)