cas: 1408168-77-3 — see every product listed under this CAS number, including other names
Potassium (2-acetoxyethyl)trifluoroborate, 98%, 98% (CAS 1408168-77-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110ESU-100mg |
| cas | 1408168-77-3 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 688.40 Pln | |
| Chemat | 5g | 2301.20 Pln | |
| Chemat | 10g | 4197.20 Pln | |
| Chemat | 25g | 8018.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Potassium 2-acetyloxyethyl(trifluoro)boranuide (CAS 1408168-77-3) is a chemical compound with the molecular formula C4H7BF3KO2 and a molecular weight of 194.00 g/mol. IUPAC name: potassium 2-acetyloxyethyl(trifluoro)boranuide. InChIKey: BWXOSUAJRCOQMR-UHFFFAOYSA-N.
| Molecular formula | C4H7BF3KO2 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | potassium 2-acetyloxyethyl(trifluoro)boranuide |
| InChIKey | BWXOSUAJRCOQMR-UHFFFAOYSA-N |
| SMILES | [B-](CCOC(=O)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)