cas: 1408168-73-9 — see every product listed under this CAS number, including other names
Potassium (2-benzyloxyethyl)trifluoroborate, 97% (CAS 1408168-73-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552723-100MG |
| cas | 1408168-73-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 10g | 1606.74 Pln | |
| Fluorochem | 25g | 3855.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Potassium trifluoro(2-phenylmethoxyethyl)boranuide (CAS 1408168-73-9) is a chemical compound with the molecular formula C9H11BF3KO and a molecular weight of 242.09 g/mol. IUPAC name: potassium trifluoro(2-phenylmethoxyethyl)boranuide. InChIKey: XMZYLFXZFPICER-UHFFFAOYSA-N.
| Molecular formula | C9H11BF3KO |
|---|---|
| Molecular weight | 242.09 g/mol |
| IUPAC name | potassium trifluoro(2-phenylmethoxyethyl)boranuide |
| InChIKey | XMZYLFXZFPICER-UHFFFAOYSA-N |
| SMILES | [B-](CCOCC1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)