cas: 42298-15-7 — see every product listed under this CAS number, including other names
Potassium (trifluoromethyl)trifluoroborate, 97% (CAS 42298-15-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554873-250MG |
| cas | 42298-15-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 581.06 Pln | |
| Fluorochem | 25g | 1205.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Potassium trifluoro(trifluoromethyl)boranuide (CAS 42298-15-7) is a chemical compound with the molecular formula CBF6K and a molecular weight of 175.91 g/mol. IUPAC name: potassium trifluoro(trifluoromethyl)boranuide. InChIKey: UOGBGCVSVMQVBR-UHFFFAOYSA-N.
| Molecular formula | CBF6K |
|---|---|
| Molecular weight | 175.91 g/mol |
| IUPAC name | potassium trifluoro(trifluoromethyl)boranuide |
| InChIKey | UOGBGCVSVMQVBR-UHFFFAOYSA-N |
| SMILES | [B-](C(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)