Potassium [1,1'-biphenyl]-2-yltrifluoroborate, 98%
cas: 1456913-20-4 — see every product listed under this CAS number, including other names
Potassium [1,1'-biphenyl]-2-yltrifluoroborate, 98% (CAS 1456913-20-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1461169-1g |
| cas | 1456913-20-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 793.12 Pln | |
| Ambeed | 10g | 1193.62 Pln | |
| Ambeed | 25g | 2406.25 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 853.06 Pln | |
| BLDpharm | 10g | 1280.68 Pln | |
| BLDpharm | 25g | 2591.33 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2469.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Potassium trifluoro-(2-phenylphenyl)boranuide (CAS 1456913-20-4) is a chemical compound with the molecular formula C12H9BF3K and a molecular weight of 260.11 g/mol. IUPAC name: potassium trifluoro-(2-phenylphenyl)boranuide. InChIKey: PQFHGVJPZUXCTE-UHFFFAOYSA-N.
| Molecular formula | C12H9BF3K |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | potassium trifluoro-(2-phenylphenyl)boranuide |
| InChIKey | PQFHGVJPZUXCTE-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1C2=CC=CC=C2)(F)(F)F.[K+] |
Computed by PubChem (NCBI)