cas: 1015533-35-3 — see every product listed under this CAS number, including other names
Potassium 2-(2-methyl-1H-benzo[d]imidazol-1-yl)acetate, 98%, 98% (CAS 1015533-35-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H0HT-100mg |
| cas | 1015533-35-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 578.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Potassium 2-(2-methylbenzimidazol-1-yl)acetate (CAS 1015533-35-3) is a chemical compound with the molecular formula C10H9KN2O2 and a molecular weight of 228.29 g/mol. IUPAC name: potassium 2-(2-methylbenzimidazol-1-yl)acetate. InChIKey: XRPVBBDULKSUIF-UHFFFAOYSA-M.
| Molecular formula | C10H9KN2O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | potassium 2-(2-methylbenzimidazol-1-yl)acetate |
| InChIKey | XRPVBBDULKSUIF-UHFFFAOYSA-M |
| SMILES | CC1=NC2=CC=CC=C2N1CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)