CAS 42967-55-5 appears in our catalog under these names: Terephthalic acid monomethyl ester potassium salt, 95%, Potassium Monomethyl Terephthalate, Potassium Monomethyl Terephthalate, >95.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
Potassium 4-methoxycarbonylbenzoate (CAS 42967-55-5) is a chemical compound with the molecular formula C9H7KO4 and a molecular weight of 218.25 g/mol. IUPAC name: potassium 4-methoxycarbonylbenzoate. InChIKey: DWNDFZTVSFSFTB-UHFFFAOYSA-M.
| Molecular formula | C9H7KO4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | potassium 4-methoxycarbonylbenzoate |
| InChIKey | DWNDFZTVSFSFTB-UHFFFAOYSA-M |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)