CAS 78135-07-6 appears in our catalog under these names: Potassium 4-chlorobenzenesulfonate, 98%, 98%, Potassium 4-chlorobenzenesulfonate, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Potassium 4-chlorobenzenesulfonate (CAS 78135-07-6) is a chemical compound with the molecular formula C6H4ClKO3S and a molecular weight of 230.71 g/mol. IUPAC name: potassium 4-chlorobenzenesulfonate. InChIKey: CRAWBPGXIICWMH-UHFFFAOYSA-M.
| Molecular formula | C6H4ClKO3S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | potassium 4-chlorobenzenesulfonate |
| InChIKey | CRAWBPGXIICWMH-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1S(=O)(=O)[O-])Cl.[K+] |
Computed by PubChem (NCBI)