Potassium 4-nitrophenyl sulfate, 98%
cas: 6217-68-1 — see every product listed under this CAS number, including other names
Potassium 4-nitrophenyl sulfate, 98% (CAS 6217-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A928840-250mg |
| cas | 6217-68-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1410.56 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1336.40 Pln | |
| BLDpharm | 100mg | 181.07 Pln | |
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1513.94 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Potassium (4-nitrophenyl) sulfate (CAS 6217-68-1) is a chemical compound with the molecular formula C6H4KNO6S and a molecular weight of 257.26 g/mol. IUPAC name: potassium (4-nitrophenyl) sulfate. InChIKey: BITVAZYUWRLLCN-UHFFFAOYSA-M.
| Molecular formula | C6H4KNO6S |
|---|---|
| Molecular weight | 257.26 g/mol |
| IUPAC name | potassium (4-nitrophenyl) sulfate |
| InChIKey | BITVAZYUWRLLCN-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)
Synonyms:
Potassium 4-nitrophenyl sulfate, Sulfuric acid, mono(4-nitrophenyl) ester, potassium salt, potassium p-nitrophenyl sulfate, Phenol, p-nitro-, hydrogen sulfate (ester), potassium salt, Potassium 4nitrophenyl sulphate, 4Nitrophenyl sulfate potassium salt, p-nitrophenyl sufate potassium salt, Phenol, pnitro, hydrogen sulfate (ester), potassium salt, Sulfuric acid, mono(4nitrophenyl) ester, potassium salt, P-NITROPHENYL SULFATE POTASSIUM SALT