Potassium tert-butyltrifluoroborate, 95%
cas: 1260112-05-7 — see every product listed under this CAS number, including other names
Potassium tert-butyltrifluoroborate, 95% (CAS 1260112-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F547181-100MG |
| cas | 1260112-05-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 336.36 Pln | |
| Fluorochem | 5g | 804.94 Pln | |
| Fluorochem | 10g | 1497.41 Pln | |
| Fluorochem | 25g | 2694.90 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 782.00 Pln | |
| Ambeed | 10g | 1449.50 Pln | |
| Ambeed | 25g | 3418.62 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 853.06 Pln | |
| BLDpharm | 10g | 1569.47 Pln | |
| BLDpharm | 25g | 3690.95 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Potassium tert-butyl(trifluoro)boranuide (CAS 1260112-05-7) is a chemical compound with the molecular formula C4H9BF3K and a molecular weight of 164.02 g/mol. IUPAC name: potassium tert-butyl(trifluoro)boranuide. InChIKey: DUBQQKQAMBSJQA-UHFFFAOYSA-N.
| Molecular formula | C4H9BF3K |
|---|---|
| Molecular weight | 164.02 g/mol |
| IUPAC name | potassium tert-butyl(trifluoro)boranuide |
| InChIKey | DUBQQKQAMBSJQA-UHFFFAOYSA-N |
| SMILES | [B-](C(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)