cas: 850623-67-5 — see every product listed under this CAS number, including other names
Potassium trifluoro(3-(methylsulfonamido)phenyl)borate 97% (CAS 850623-67-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A138949-250mg |
| cas | 850623-67-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1082.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A138949 |
Potassium trifluoro-[3-(methanesulfonamido)phenyl]boranuide (CAS 850623-67-5) is a chemical compound with the molecular formula C7H8BF3KNO2S and a molecular weight of 277.12 g/mol. IUPAC name: potassium trifluoro-[3-(methanesulfonamido)phenyl]boranuide. InChIKey: BEFKEEZRFRQEEP-UHFFFAOYSA-N.
| Molecular formula | C7H8BF3KNO2S |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | potassium trifluoro-[3-(methanesulfonamido)phenyl]boranuide |
| InChIKey | BEFKEEZRFRQEEP-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC=C1)NS(=O)(=O)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)