cas: 1023357-63-2 — see every product listed under this CAS number, including other names
Potassium trifluoro(3-methoxy-3-oxopropyl)borate, 98% (CAS 1023357-63-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F053826-100MG |
| cas | 1023357-63-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1346.42 Pln | |
| Fluorochem | 10g | 2101.36 Pln | |
| Fluorochem | 25g | 4111.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide (CAS 1023357-63-2) is a chemical compound with the molecular formula C4H7BF3KO2 and a molecular weight of 194.00 g/mol. IUPAC name: potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide. InChIKey: NPWJZDRICBCMOK-UHFFFAOYSA-N.
| Molecular formula | C4H7BF3KO2 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide |
| InChIKey | NPWJZDRICBCMOK-UHFFFAOYSA-N |
| SMILES | [B-](CCC(=O)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)