cas: 1366170-42-4 — see every product listed under this CAS number, including other names
Potassium trifluoro(3-oxocyclopentyl)borate, 95%, 95% (CAS 1366170-42-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12D9S8-100mg |
| cas | 1366170-42-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1130.00 Pln | |
| Chemat | 250mg | 1586.00 Pln | |
| Chemat | 1g | 3102.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Potassium trifluoro-(3-oxocyclopentyl)boranuide (CAS 1366170-42-4) is a chemical compound with the molecular formula C5H7BF3KO and a molecular weight of 190.02 g/mol. IUPAC name: potassium trifluoro-(3-oxocyclopentyl)boranuide. InChIKey: ZLNOTXHPFABSDP-UHFFFAOYSA-N.
| Molecular formula | C5H7BF3KO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | potassium trifluoro-(3-oxocyclopentyl)boranuide |
| InChIKey | ZLNOTXHPFABSDP-UHFFFAOYSA-N |
| SMILES | [B-](C1CCC(=O)C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)