Potassium trifluoro(phenyl)borate, 97%
cas: 153766-81-5 — see every product listed under this CAS number, including other names
Potassium trifluoro(phenyl)borate, 97% (CAS 153766-81-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A145448-250mg |
| cas | 153766-81-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 2139.25 Pln | |
| Ambeed | 1kg | 3591.06 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 371.60 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 269.93 Pln | |
| BLDpharm | 100g | 519.84 Pln | |
| BLDpharm | 500g | 2302.55 Pln | |
| BLDpharm | 1kg | 3863.11 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Potassium trifluoro(phenyl)boranuide (CAS 153766-81-5) is a chemical compound with the molecular formula C6H5BF3K and a molecular weight of 184.01 g/mol. IUPAC name: potassium trifluoro(phenyl)boranuide. InChIKey: DVAFPKUGAUFBTJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3K |
|---|---|
| Molecular weight | 184.01 g/mol |
| IUPAC name | potassium trifluoro(phenyl)boranuide |
| InChIKey | DVAFPKUGAUFBTJ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)
Synonyms:
Potassium phenyltrifluoroborate, Potassium trifluoro(phenyl)borate, potassium trifluoro(phenyl)boranuide, potassium;trifluoro(phenyl)boranuide, Potassium trifluoro(phenyl)borate(1-), Potassiumtrifluoro(phenyl)borate, Potassium trifluoridophenylborate(1-), potassium tris(fluoranyl)-phenyl-boranuide