cas: 2246895-97-4 — see every product listed under this CAS number, including other names
Propanamide, N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethyl-, 95%, 95% (CAS 2246895-97-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11RQLT-250mg |
| cas | 2246895-97-4 |
| size | 250mg |
| availability | 5.54g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 7504.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylpropanamide (CAS 2246895-97-4) is a chemical compound with the molecular formula C17H25BFNO3 and a molecular weight of 321.2 g/mol. IUPAC name: N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylpropanamide. InChIKey: SBMZYZQZGQNMPK-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO3 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | SBMZYZQZGQNMPK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC(=O)C(C)(C)C)F |
Computed by PubChem (NCBI)