cas: 122008-82-6 — see every product listed under this CAS number, including other names
Propanoic acid, 2-[4-(4-cyano-2-fluorophenoxy)phenoxy]-, butyl ester, 97%, 97% (CAS 122008-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127M2-100mg |
| cas | 122008-82-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 938.00 Pln | |
| Chemat | 1g | 2416.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Butyl 2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate (CAS 122008-82-6) is a chemical compound with the molecular formula C20H20FNO4 and a molecular weight of 357.4 g/mol. IUPAC name: butyl 2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate. InChIKey: TYIYMOAHACZAMQ-UHFFFAOYSA-N.
| Molecular formula | C20H20FNO4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | butyl 2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate |
| InChIKey | TYIYMOAHACZAMQ-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(C)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)C#N)F |
Computed by PubChem (NCBI)