Propargyl-PEG5-acid, 98%, 98%
cas: 1245823-51-1 — see every product listed under this CAS number, including other names
Propargyl-PEG5-acid, 98%, 98% (CAS 1245823-51-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HHPJ-100mg |
| cas | 1245823-51-1 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2541.20 Pln | |
| Chemat | 100g | 3851.60 Pln | |
| Chemat | 250g | 6515.60 Pln | |
| Chemat | 500g | 8985.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1245823-51-1) is a chemical compound with the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. IUPAC name: 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: GWIACWQVTBMVEI-UHFFFAOYSA-N.
| Molecular formula | C14H24O7 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | GWIACWQVTBMVEI-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
propargyl-PEG5-Acid, 4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid, Alkyne-PEG5-acid, Alkyne-PEG5-COOH, Propargyl-PEG4-CH2CH2COOH, Propyne-PEG4-CH2CH2COOH, 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid, Propargyl-PEG5-COOH, Propargyl-PEG4-C2-acid, Alkyne-PEG4-carboxylic acid