Punicalagin, 98%
cas: 65995-63-3 — see every product listed under this CAS number, including other names
Punicalagin, 98% (CAS 65995-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A471582-250mg |
| cas | 65995-63-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2806.75 Pln | |
| Ambeed | 1g | 7451.44 Pln | |
| Chemat | 1mg | 141.20 Pln | |
| Chemat | 5mg | 266.00 Pln | |
| Chemat | 10mg | 390.80 Pln | |
| Chemat | 25mg | 683.60 Pln | |
| Chemat | 50mg | 1053.20 Pln | |
| Chemat | 100mg | 1643.60 Pln | |
| Chemat | 250mg | 2747.60 Pln | |
| Chemat | 1g | 7317.20 Pln | |
| Fluorochem | 5mg | 476.93 Pln | |
| Fluorochem | 25mg | 1263.11 Pln | |
| Fluorochem | 50mg | 1945.17 Pln | |
| Fluorochem | 100mg | 3059.36 Pln | |
| Fluorochem | 250mg | 5089.89 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,4,5,16,17,18-hexahydroxy-8,13-dioxo-11-(3,4,5,11,17,18,19,22,23,34,35-undecahydroxy-8,14,26,31-tetraoxo-9,13,25,32-tetraoxaheptacyclo[25.8.0.02,7.015,20.021,30.024,29.028,33]pentatriaconta-1(35),2,4,6,15,17,19,21,23,27,29,33-dodecaen-10-yl)-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaene-10-carbaldehyde (CAS 65995-63-3) is a chemical compound with the molecular formula C48H28O30 and a molecular weight of 1084.7 g/mol. IUPAC name: 3,4,5,16,17,18-hexahydroxy-8,13-dioxo-11-(3,4,5,11,17,18,19,22,23,34,35-undecahydroxy-8,14,26,31-tetraoxo-9,13,25,32-tetraoxaheptacyclo[25.8.0.02,7.015,20.021,30.024,29.028,33]pentatriaconta-1(35),2,4,6,15,17,19,21,23,27,29,33-dodecaen-10-yl)-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaene-10-carbaldehyde. InChIKey: SKNLUADAGHCXKF-UHFFFAOYSA-N.
| Molecular formula | C48H28O30 |
|---|---|
| Molecular weight | 1084.7 g/mol |
| IUPAC name | 3,4,5,16,17,18-hexahydroxy-8,13-dioxo-11-(3,4,5,11,17,18,19,22,23,34,35-undecahydroxy-8,14,26,31-tetraoxo-9,13,25,32-tetraoxaheptacyclo[25.8.0.02,7.015,20.021,30.024,29.028,33]pentatriaconta-1(35),2,4,6,15,17,19,21,23,27,29,33-dodecaen-10-yl)-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaene-10-carbaldehyde |
| InChIKey | SKNLUADAGHCXKF-UHFFFAOYSA-N |
| SMILES | C1C(C(OC(=O)C2=CC(=C(C(=C2C3=C(C(=C4C5=C3C(=O)OC6=C(C(=C(C7=C(C(=C(C=C7C(=O)O1)O)O)O)C(=C56)C(=O)O4)O)O)O)O)O)O)O)C8C(OC(=O)C9=CC(=C(C(=C9C1=C(C(=C(C=C1C(=O)O8)O)O)O)O)O)O)C=O)O |
Computed by PubChem (NCBI)