cas: 201998-61-0 — see every product listed under this CAS number, including other names
Py-Bodipy-NHS ester, 97%, 97% (CAS 201998-61-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V85K-5mg |
| cas | 201998-61-0 |
| size | 5mg |
| availability | 2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 400.40 Pln | |
| Chemat | 10mg | 645.20 Pln | |
| Chemat | 25mg | 1192.40 Pln | |
| Chemat | 50mg | 1571.60 Pln | |
| Chemat | 100mg | 1955.60 Pln | |
| Chemat | 250mg | 3218.00 Pln | |
| Chemat | 500mg | 5637.20 Pln | |
| Chemat | 1g | 9218.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2,2-difluoro-12-(1H-pyrrol-2-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl]propanoate (CAS 201998-61-0) is a chemical compound with the molecular formula C20H17BF2N4O4 and a molecular weight of 426.2 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2,2-difluoro-12-(1H-pyrrol-2-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl]propanoate. InChIKey: CRGDXALGAHKHRS-UHFFFAOYSA-N.
| Molecular formula | C20H17BF2N4O4 |
|---|---|
| Molecular weight | 426.2 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2,2-difluoro-12-(1H-pyrrol-2-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl]propanoate |
| InChIKey | CRGDXALGAHKHRS-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC=C2CCC(=O)ON3C(=O)CCC3=O)C=C4[N+]1=C(C=C4)C5=CC=CN5)(F)F |
Computed by PubChem (NCBI)