cas: 2168294-35-5 — see every product listed under this CAS number, including other names
Pyrazino[2,3-b]pyrazin-2(1H)-one, 6-bromo-3,4-dihydro-, 95%, 95% (CAS 2168294-35-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FVJC-100mg |
| cas | 2168294-35-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-7,8-dihydro-5H-pyrazino[2,3-b]pyrazin-6-one (CAS 2168294-35-5) is a chemical compound with the molecular formula C6H5BrN4O and a molecular weight of 229.03 g/mol. IUPAC name: 2-bromo-7,8-dihydro-5H-pyrazino[2,3-b]pyrazin-6-one. InChIKey: WIUUTBQOIREXQC-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN4O |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 2-bromo-7,8-dihydro-5H-pyrazino[2,3-b]pyrazin-6-one |
| InChIKey | WIUUTBQOIREXQC-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=NC=C(N=C2N1)Br |
Computed by PubChem (NCBI)