cas: 623565-14-0 — see every product listed under this CAS number, including other names
Pyrazolo[1,5-a]pyrazine-2,5(4H)-dicarboxylic acid, 6,7-dihydro-, 2-ethyl 5-[(4-nitrophenyl)methyl] ester, 98%, 98% (CAS 623565-14-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELVC-100mg |
| cas | 623565-14-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 1029.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-O-ethyl 5-O-[(4-nitrophenyl)methyl] 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2,5-dicarboxylate (CAS 623565-14-0) is a chemical compound with the molecular formula C17H18N4O6 and a molecular weight of 374.3 g/mol. IUPAC name: 2-O-ethyl 5-O-[(4-nitrophenyl)methyl] 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2,5-dicarboxylate. InChIKey: IIRGEIKLCGECFA-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O6 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-O-ethyl 5-O-[(4-nitrophenyl)methyl] 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2,5-dicarboxylate |
| InChIKey | IIRGEIKLCGECFA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2CCN(CC2=C1)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)