cas: 1073353-61-3 — see every product listed under this CAS number, including other names
Pyrrolidin-1-yl(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone (CAS 1073353-61-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696476-250MG |
| cas | 1073353-61-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 799.74 Pln | |
| Fluorochem | 25g | 2788.62 Pln |
| delivery time | 3-4 weeks |
|---|
Pyrrolidin-1-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 1073353-61-3) is a chemical compound with the molecular formula C17H24BNO3 and a molecular weight of 301.2 g/mol. IUPAC name: pyrrolidin-1-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: CLPFNNNIZHMNPT-UHFFFAOYSA-N.
| Molecular formula | C17H24BNO3 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | pyrrolidin-1-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | CLPFNNNIZHMNPT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)N3CCCC3 |
Computed by PubChem (NCBI)