cas: 1073353-55-5 — see every product listed under this CAS number, including other names
Pyrrolidin-1-yl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone, 98% (CAS 1073353-55-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232267-250MG |
| cas | 1073353-55-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 5g | 414.46 Pln | |
| Fluorochem | 25g | 1434.93 Pln | |
| Fluorochem | 1g | 190.58 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Pyrrolidin-1-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 1073353-55-5) is a chemical compound with the molecular formula C17H24BNO3 and a molecular weight of 301.2 g/mol. IUPAC name: pyrrolidin-1-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: LVIFPVRUEPSHLJ-UHFFFAOYSA-N.
| Molecular formula | C17H24BNO3 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | pyrrolidin-1-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | LVIFPVRUEPSHLJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)N3CCCC3 |
Computed by PubChem (NCBI)