Quetiapine (hemifumarate), 99.96%
cas: 111974-72-2 — see every product listed under this CAS number, including other names
Quetiapine (hemifumarate), 99.96% (CAS 111974-72-2) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10mM/1mL, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0031-5 g |
| cas | 111974-72-2 |
| size | 5 g |
| availability | Get quote |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 691.21 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 500 mg | 263.96 Pln | |
| MedChemExpress | 1 g | 310.40 Pln |
properties
| delivery time | over 3 weeks |
|---|---|
| purity | 99.96% |
Bis(2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol);(E)-but-2-enedioic acid (CAS 111974-72-2) is a chemical compound with the molecular formula C46H54N6O8S2 and a molecular weight of 883.1 g/mol. IUPAC name: bis(2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol);(E)-but-2-enedioic acid. InChIKey: ZTHJULTYCAQOIJ-WXXKFALUSA-N.
| Molecular formula | C46H54N6O8S2 |
|---|---|
| Molecular weight | 883.1 g/mol |
| IUPAC name | bis(2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol);(E)-but-2-enedioic acid |
| InChIKey | ZTHJULTYCAQOIJ-WXXKFALUSA-N |
| SMILES | C1CN(CCN1CCOCCO)C2=NC3=CC=CC=C3SC4=CC=CC=C42.C1CN(CCN1CCOCCO)C2=NC3=CC=CC=C3SC4=CC=CC=C42.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)