CAS 117-92-0 appears in our catalog under these names: Quinaldine Red, 0, Quinaldine Red, >95% (HPLC), Quinaldine red, Quinaldine Red, dye content, 95% , Quinaldine Red, >95.0%(T). Offered by: Chemat, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 100mg, 1g, 500g, 100g, 10g, 5 g.
4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide (CAS 117-92-0) is a chemical compound with the molecular formula C21H23IN2 and a molecular weight of 430.3 g/mol. IUPAC name: 4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide. InChIKey: JOLANDVPGMEGLK-UHFFFAOYSA-M.
| Molecular formula | C21H23IN2 |
|---|---|
| Molecular weight | 430.3 g/mol |
| IUPAC name | 4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
| InChIKey | JOLANDVPGMEGLK-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C(C=CC2=CC=CC=C21)/C=C/C3=CC=C(C=C3)N(C)C.[I-] |
Computed by PubChem (NCBI)