cas: 87751-33-5 — see every product listed under this CAS number, including other names
Quinoline-3,4-diamine, 97%, 97% (CAS 87751-33-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115IE3-100mg |
| cas | 87751-33-5 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 976.40 Pln | |
| Chemat | 250mg | 1643.60 Pln | |
| Chemat | 1g | 3227.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Quinoline-3,4-diamine (CAS 87751-33-5) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: quinoline-3,4-diamine. InChIKey: UTOMICFLROGMAE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | quinoline-3,4-diamine |
| InChIKey | UTOMICFLROGMAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C=N2)N)N |
Computed by PubChem (NCBI)