Quinoline-7-carbaldehyde, 97%
cas: 49573-30-0 — see every product listed under this CAS number, including other names
Quinoline-7-carbaldehyde, 97% (CAS 49573-30-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F031495-250MG |
| cas | 49573-30-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 263.47 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 2.5g | 674.78 Pln | |
| Fluorochem | 5g | 987.17 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Quinoline-7-carbaldehyde (CAS 49573-30-0) is a chemical compound with the molecular formula C10H7NO and a molecular weight of 157.17 g/mol. IUPAC name: quinoline-7-carbaldehyde. InChIKey: WINWAFCAQPFBQA-UHFFFAOYSA-N.
| Molecular formula | C10H7NO |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | quinoline-7-carbaldehyde |
| InChIKey | WINWAFCAQPFBQA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)C=O)N=C1 |
Computed by PubChem (NCBI)