cas: 114681-65-1 — see every product listed under this CAS number, including other names
RGD peptide (GRGDNP), 99%, 99% (CAS 114681-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119RS9-1mg |
| cas | 114681-65-1 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 131.60 Pln | |
| Chemat | 5mg | 242.00 Pln | |
| Chemat | 10mg | 366.80 Pln | |
| Chemat | 25mg | 674.00 Pln | |
| Chemat | 50mg | 1106.00 Pln | |
| Chemat | 100mg | 1835.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-[(2S)-4-amino-2-[[(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid (CAS 114681-65-1) is a chemical compound with the molecular formula C23H38N10O10 and a molecular weight of 614.6 g/mol. IUPAC name: (2S)-1-[(2S)-4-amino-2-[[(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid. InChIKey: CWAHAVYVGPRZJU-XUXIUFHCSA-N.
| Molecular formula | C23H38N10O10 |
|---|---|
| Molecular weight | 614.6 g/mol |
| IUPAC name | (2S)-1-[(2S)-4-amino-2-[[(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | CWAHAVYVGPRZJU-XUXIUFHCSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](CC(=O)N)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)C(=O)O |
Computed by PubChem (NCBI)