RH01386
cas: 301177-36-6 — see every product listed under this CAS number, including other names
RH01386 (CAS 301177-36-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC70570-1 |
| cas | 301177-36-6 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 962.12 Pln | |
| GLPBio | 10mg | 2183.73 Pln | |
| GLPBio | 25mg | 3278.97 Pln | |
| GLPBio | 5mg | 1636.11 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1584.63 Pln | |
| GLPBio | 50mg | 4332.08 Pln | |
| Chemat | 2mg | 664.40 Pln | |
| Chemat | 200mg | 5560.40 Pln | |
| Chemat | 1mg | 453.20 Pln | |
| Chemat | 5mg | 1019.60 Pln | |
| Chemat | 10mg | 1480.40 Pln | |
| Chemat | 25mg | 2363.60 Pln | |
| Chemat | 50mg | 3222.80 Pln | |
| Chemat | 100mg | 4134.80 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-cyclohexyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (CAS 301177-36-6) is a chemical compound with the molecular formula C18H15F3N4O3S and a molecular weight of 424.4 g/mol. IUPAC name: 4-cyclohexyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile. InChIKey: BVWCKDMNROTYMZ-UHFFFAOYSA-N.
| Molecular formula | C18H15F3N4O3S |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | 4-cyclohexyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| InChIKey | BVWCKDMNROTYMZ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C(=O)NC(=N2)SC3=C(C=C(C=C3)C(F)(F)F)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)