cas: 2765081-21-6 — see every product listed under this CAS number, including other names
RMC6236, 98%, 98% (CAS 2765081-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134RMD-1mg |
| cas | 2765081-21-6 |
| size | 1mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 126.80 Pln | |
| Chemat | 5mg | 213.20 Pln | |
| Chemat | 10mg | 280.40 Pln | |
| Chemat | 25mg | 510.80 Pln | |
| Chemat | 50mg | 784.40 Pln | |
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1509.20 Pln | |
| Chemat | 1g | 2958.80 Pln | |
| Chemat | 5g | 11128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,2S)-N-[(7S,13S)-21-ethyl-20-[2-[(1S)-1-methoxyethyl]-5-(4-methylpiperazin-1-yl)-3-pyridinyl]-17,17-dimethyl-8,14-dioxo-15-oxa-4-thia-9,21,27,28-tetrazapentacyclo[17.5.2.12,5.19,13.022,26]octacosa-1(25),2,5(28),19,22(26),23-hexaen-7-yl]-2-methylcyclopropane-1-carboxamide (CAS 2765081-21-6) is a chemical compound with the molecular formula C44H58N8O5S and a molecular weight of 811.0 g/mol. IUPAC name: trans-(1S,2S)-N-[(7S,13S)-21-ethyl-20-[2-[(1S)-1-methoxyethyl]-5-(4-methylpiperazin-1-yl)-3-pyridinyl]-17,17-dimethyl-8,14-dioxo-15-oxa-4-thia-9,21,27,28-tetrazapentacyclo[17.5.2.12,5.19,13.022,26]octacosa-1(25),2,5(28),19,22(26),23-hexaen-7-yl]-2-methylcyclopropane-1-carboxamide. InChIKey: FVICRBSEYSHKFY-JYQNNKODSA-N.
| Molecular formula | C44H58N8O5S |
|---|---|
| Molecular weight | 811.0 g/mol |
| IUPAC name | trans-(1S,2S)-N-[(7S,13S)-21-ethyl-20-[2-[(1S)-1-methoxyethyl]-5-(4-methylpiperazin-1-yl)-3-pyridinyl]-17,17-dimethyl-8,14-dioxo-15-oxa-4-thia-9,21,27,28-tetrazapentacyclo[17.5.2.12,5.19,13.022,26]octacosa-1(25),2,5(28),19,22(26),23-hexaen-7-yl]-2-methylcyclopropane-1-carboxamide |
| InChIKey | FVICRBSEYSHKFY-JYQNNKODSA-N |
| SMILES | CCN1C2=C3C=C(C=C2)C4=CSC(=N4)C[C@@H](C(=O)N5CCC[C@H](N5)C(=O)OCC(CC3=C1C6=C(N=CC(=C6)N7CCN(CC7)C)[C@H](C)OC)(C)C)NC(=O)[C@H]8C[C@@H]8C |
Computed by PubChem (NCBI)