CAS 1859141-26-6 appears in our catalog under these names: ROC-325/ 99.26% (existing batch purity), ROC–325, ROC 325, 1-{[2-({2-[(7-chloroquinolin-4-yl)amino]ethyl}(methyl)amino)ethyl]amino}-4-methyl-9H-thioxanthen-9-one, 98%, 98%, ROC-325, 98.73%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
1-[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-methylamino]ethylamino]-4-methylthioxanthen-9-one (CAS 1859141-26-6) is a chemical compound with the molecular formula C28H27ClN4OS and a molecular weight of 503.1 g/mol. IUPAC name: 1-[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-methylamino]ethylamino]-4-methylthioxanthen-9-one. InChIKey: HXUYKEGAEIYPKY-UHFFFAOYSA-N.
| Molecular formula | C28H27ClN4OS |
|---|---|
| Molecular weight | 503.1 g/mol |
| IUPAC name | 1-[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-methylamino]ethylamino]-4-methylthioxanthen-9-one |
| InChIKey | HXUYKEGAEIYPKY-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)NCCN(C)CCNC3=C4C=CC(=CC4=NC=C3)Cl)C(=O)C5=CC=CC=C5S2 |
Computed by PubChem (NCBI)