CAS 149719-06-2 appears in our catalog under these names: RS 23597-190 HCl, 98+%, RS 23597-190 hydrochloride, RS 23597–190 hydrochloride, 3-(Piperidin-1-yl)propyl 4-amino-5-chloro-2-methoxybenzoate hydrochloride, 98+%, 98+%, RS 23597-190, 99.06%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 10mg, 50mg, 25mg, 25 mg, 100 mg, 50 mg.
3-piperidin-1-ylpropyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride (CAS 149719-06-2) is a chemical compound with the molecular formula C16H24Cl2N2O3 and a molecular weight of 363.3 g/mol. IUPAC name: 3-piperidin-1-ylpropyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride. InChIKey: QLZLBYYNMGQIAR-UHFFFAOYSA-N.
| Molecular formula | C16H24Cl2N2O3 |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | 3-piperidin-1-ylpropyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride |
| InChIKey | QLZLBYYNMGQIAR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OCCCN2CCCCC2)Cl)N.Cl |
Computed by PubChem (NCBI)