CAS 1187856-49-0 appears in our catalog under these names: Ralinepag, Ralinepag (APD811), 2-[[trans-4-[[[[(4-Chlorophenyl)phenylamino]carbonyl]oxy]methyl]cyclohexyl]methoxy]acetic acid, 98%, 98%, Ralinepag, 99.27%, Ralinepag, ≥98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetic acid (CAS 1187856-49-0) is a chemical compound with the molecular formula C23H26ClNO5 and a molecular weight of 431.9 g/mol. IUPAC name: 2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetic acid. InChIKey: NPDKXVKJRHPDQT-UHFFFAOYSA-N.
| Molecular formula | C23H26ClNO5 |
|---|---|
| Molecular weight | 431.9 g/mol |
| IUPAC name | 2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetic acid |
| InChIKey | NPDKXVKJRHPDQT-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1COCC(=O)O)COC(=O)N(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)