Rapamycin, 98%
cas: 53123-88-9 — see every product listed under this CAS number, including other names
Rapamycin, 98% (CAS 53123-88-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat, Fluorochem, Ambeed.
| brand | Chemat |
|---|---|
| catalog number | Ch1146KC-10mg |
| cas | 53123-88-9 |
| size | 10mg |
| availability | 250g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 88.40 Pln | |
| Chemat | 50mg | 93.20 Pln | |
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 50mg | 133.30 Pln | |
| Fluorochem | 10mg | 133.30 Pln | |
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 500mg | 263.47 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1492.20 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1922.31 Pln | |
| Ambeed | 25g | 6422.38 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 88.40 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 165.20 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 10g | 1442.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sirolimus is a macrolide lactam isolated from Streptomyces hygroscopicus consisting of a 29-membered ring containing 4 trans double bonds, three of which are conjugated. It is an antibiotic, immunosupressive and antineoplastic agent. It has a role as an anticoronaviral agent, a geroprotector, an antineoplastic agent, an immunosuppressive agent, an antibacterial drug, a mTOR inhibitor and a bacterial metabolite. It is a macrolide lactam, an ether, an organic heterotricyclic compound, a secondary alcohol, a cyclic ketone, a cyclic acetal and an antibiotic antifungal drug.
Source: ChEBI
| Molecular formula | C51H79NO13 |
|---|---|
| Molecular weight | 914.2 g/mol |
| IUPAC name | (1R,9S,12S,15R,16E,18R,19R,21R,23S,24E,26E,28E,30S,32S,35R)-1,18-dihydroxy-12-[(2R)-1-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]propan-2-yl]-19,30-dimethoxy-15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraene-2,3,10,14,20-pentone |
| InChIKey | QFJCIRLUMZQUOT-HPLJOQBZSA-N |
| SMILES | C[C@@H]1CC[C@H]2C[C@@H](/C(=C/C=C/C=C/[C@H](C[C@H](C(=O)[C@@H]([C@@H](/C(=C/[C@H](C(=O)C[C@H](OC(=O)[C@@H]3CCCCN3C(=O)C(=O)[C@@]1(O2)O)[C@H](C)C[C@@H]4CC[C@H]([C@@H](C4)OC)O)C)/C)O)OC)C)C)/C)OC |
Computed by PubChem (NCBI)
Synonyms:
rapamycin, Sirolimus, (-)-Rapamycin, Rapamune, rapalimus, FYARRO, HYFTOR, sirolimusum, Npc-12g, Antibiotic AY 22989