Resmetirom 99%
cas: 920509-32-6 — see every product listed under this CAS number, including other names
Resmetirom 99% (CAS 920509-32-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A679714-1mg |
| cas | 920509-32-6 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 131.19 Pln | |
| Ambeed | 5mg | 147.88 Pln | |
| Ambeed | 10mg | 186.81 Pln | |
| Ambeed | 25mg | 275.81 Pln | |
| Ambeed | 50mg | 403.75 Pln | |
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1772.12 Pln | |
| Ambeed | 5g | 6010.75 Pln | |
| Ambeed | 25g | 20267.44 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A679714 |
2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (CAS 920509-32-6) is a chemical compound with the molecular formula C17H12Cl2N6O4 and a molecular weight of 435.2 g/mol. IUPAC name: 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile. InChIKey: FDBYIYFVSAHJLY-UHFFFAOYSA-N.
| Molecular formula | C17H12Cl2N6O4 |
|---|---|
| Molecular weight | 435.2 g/mol |
| IUPAC name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| InChIKey | FDBYIYFVSAHJLY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NNC1=O)OC2=C(C=C(C=C2Cl)N3C(=O)NC(=O)C(=N3)C#N)Cl |
Computed by PubChem (NCBI)