CAS 152121-30-7 appears in our catalog under these names: SB 202190, >95% (HPLC), SB 202190/ 99.67% (existing batch purity), SB202190 (FHPI), SB 202190, 99+% , SB 202190. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 250mg, 50mg, 25mg, 100mg, 200mg, 10mg, 10mM (in 1ml dmso).
4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]phenol (CAS 152121-30-7) is a chemical compound with the molecular formula C20H14FN3O and a molecular weight of 331.3 g/mol. IUPAC name: 4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]phenol. InChIKey: QHKYPYXTTXKZST-UHFFFAOYSA-N.
| Molecular formula | C20H14FN3O |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | 4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]phenol |
| InChIKey | QHKYPYXTTXKZST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F)O |
Computed by PubChem (NCBI)