SM-324405, 98%
cas: 677773-91-0 — see every product listed under this CAS number, including other names
SM-324405, 98% (CAS 677773-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A839990-100mg |
| cas | 677773-91-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1532.94 Pln | |
| Ambeed | 250mg | 2422.94 Pln | |
| Ambeed | 1g | 7607.19 Pln | |
| Chemat | 1mg | 184.40 Pln | |
| Chemat | 5mg | 213.20 Pln | |
| Chemat | 10mg | 314.00 Pln | |
| Chemat | 25mg | 563.60 Pln | |
| Chemat | 50mg | 914.00 Pln | |
| Chemat | 100mg | 1427.60 Pln | |
| Chemat | 250mg | 2382.80 Pln | |
| Chemat | 1g | 7480.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate (CAS 677773-91-0) is a chemical compound with the molecular formula C19H23N5O4 and a molecular weight of 385.4 g/mol. IUPAC name: methyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate. InChIKey: MXILFZWMVNDOIZ-UHFFFAOYSA-N.
| Molecular formula | C19H23N5O4 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | methyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate |
| InChIKey | MXILFZWMVNDOIZ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=NC(=C2C(=N1)N(C(=O)N2)CC3=CC=CC(=C3)CC(=O)OC)N |
Computed by PubChem (NCBI)