CAS 2682114-54-9 appears in our catalog under these names: SP–96, SP-96/ 99.52% (existing batch purity), SP-96, SP-96, 99%, 99%, SP-96, 99.65%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 50 mg, 10 mg.
1-(3-fluorophenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea (CAS 2682114-54-9) is a chemical compound with the molecular formula C25H20FN7O and a molecular weight of 453.5 g/mol. IUPAC name: 1-(3-fluorophenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea. InChIKey: CGDYRZUPKPBLND-UHFFFAOYSA-N.
| Molecular formula | C25H20FN7O |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea |
| InChIKey | CGDYRZUPKPBLND-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC3=C(C=C2)C(=NC=N3)NC4=CC(=CC=C4)NC(=O)NC5=CC(=CC=C5)F |
Computed by PubChem (NCBI)