CAS 724741-75-7 appears in our catalog under these names: STF-31/ 99.92% (existing batch purity), STF 31, STF 31, STF-31, >98.0%(HPLC)(qNMR), STF-31. Offered by: TargetMol, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-pyridin-3-ylbenzamide (CAS 724741-75-7) is a chemical compound with the molecular formula C23H25N3O3S and a molecular weight of 423.5 g/mol. IUPAC name: 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-pyridin-3-ylbenzamide. InChIKey: NGQPRVWTFNBUHA-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O3S |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
| InChIKey | NGQPRVWTFNBUHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)NC3=CN=CC=C3 |
Computed by PubChem (NCBI)