cas: 1639792-20-3 — see every product listed under this CAS number, including other names
Saroglitazar magnesium 99% (CAS 1639792-20-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A670211-1mg |
| cas | 1639792-20-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 164.56 Pln | |
| Ambeed | 5mg | 298.06 Pln | |
| Ambeed | 10mg | 409.31 Pln | |
| Ambeed | 25mg | 648.50 Pln | |
| Ambeed | 50mg | 1037.88 Pln | |
| Ambeed | 100mg | 1716.50 Pln | |
| Ambeed | 250mg | 3018.12 Pln | |
| Ambeed | 1g | 9509.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A670211 |
Magnesium bis((2S)-2-ethoxy-3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoate) (CAS 1639792-20-3) is a chemical compound with the molecular formula C50H56MgN2O8S2 and a molecular weight of 901.4 g/mol. IUPAC name: magnesium bis((2S)-2-ethoxy-3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoate). InChIKey: UJYFZCVPOSZDMK-YPPDDXJESA-L.
| Molecular formula | C50H56MgN2O8S2 |
|---|---|
| Molecular weight | 901.4 g/mol |
| IUPAC name | magnesium bis((2S)-2-ethoxy-3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoate) |
| InChIKey | UJYFZCVPOSZDMK-YPPDDXJESA-L |
| SMILES | CCO[C@@H](CC1=CC=C(C=C1)OCCN2C(=CC=C2C3=CC=C(C=C3)SC)C)C(=O)[O-].CCO[C@@H](CC1=CC=C(C=C1)OCCN2C(=CC=C2C3=CC=C(C=C3)SC)C)C(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)