cas: 58546-54-6 — see every product listed under this CAS number, including other names
Schisandrol B 99+% (CAS 58546-54-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A134812-1mg |
| cas | 58546-54-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 320.31 Pln | |
| Ambeed | 5mg | 381.50 Pln | |
| Ambeed | 10mg | 576.19 Pln | |
| Ambeed | 25mg | 1071.25 Pln | |
| Ambeed | 50mg | 1683.12 Pln | |
| Ambeed | 100mg | 2645.44 Pln | |
| Ambeed | 250mg | 3340.75 Pln | |
| Ambeed | 1g | 4803.69 Pln |
| purity | 99+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A134812 |
(9R,10S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-9-ol (CAS 58546-54-6) is a chemical compound with the molecular formula C23H28O7 and a molecular weight of 416.5 g/mol. IUPAC name: (9R,10S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-9-ol. InChIKey: ZWRRJEICIPUPHZ-DAOPMYJZSA-N.
| Molecular formula | C23H28O7 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | (9R,10S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-9-ol |
| InChIKey | ZWRRJEICIPUPHZ-DAOPMYJZSA-N |
| SMILES | C[C@H]1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C[C@@]1(C)O)OC)OC)OC)OC)OCO3 |
Computed by PubChem (NCBI)