cas: 50651-75-7 — see every product listed under this CAS number, including other names
Silver(I) dibenzyl phosphate, 97% (CAS 50651-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F054460-100MG |
| cas | 50651-75-7 |
| size | 100mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 500mg | 169.75 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 2.5g | 482.14 Pln | |
| Fluorochem | 5g | 737.26 Pln | |
| Fluorochem | 10g | 1278.73 Pln | |
| Fluorochem | 25g | 2767.79 Pln | |
| Fluorochem | 50g | 4803.53 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Silver dibenzyl phosphate (CAS 50651-75-7) is a chemical compound with the molecular formula C14H14AgO4P and a molecular weight of 385.10 g/mol. IUPAC name: silver dibenzyl phosphate. InChIKey: IWOLVLSIZCEOHM-UHFFFAOYSA-M.
| Molecular formula | C14H14AgO4P |
|---|---|
| Molecular weight | 385.10 g/mol |
| IUPAC name | silver dibenzyl phosphate |
| InChIKey | IWOLVLSIZCEOHM-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)COP(=O)([O-])OCC2=CC=CC=C2.[Ag+] |
Computed by PubChem (NCBI)