Sodium (Z)-octadec-9-en-1-yl sulfate, 90%
cas: 1847-55-8 — see every product listed under this CAS number, including other names
Sodium (Z)-octadec-9-en-1-yl sulfate, 90% (CAS 1847-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1196865-100mg |
| cas | 1847-55-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1532.94 Pln | |
| Ambeed | 5g | 5154.12 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Chemat | 5g | 3338.00 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 630.91 Pln | |
| BLDpharm | 1g | 1502.83 Pln | |
| BLDpharm | 5g | 5057.13 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
Sodium [(Z)-octadec-9-enyl] sulfate (CAS 1847-55-8) is a chemical compound with the molecular formula C18H35NaO4S and a molecular weight of 370.5 g/mol. IUPAC name: sodium [(Z)-octadec-9-enyl] sulfate. InChIKey: MWZFQMUXPSUDJQ-KVVVOXFISA-M.
| Molecular formula | C18H35NaO4S |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | sodium [(Z)-octadec-9-enyl] sulfate |
| InChIKey | MWZFQMUXPSUDJQ-KVVVOXFISA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Sodium oleyl sulfate, oleyl sodium sulfate, 9-Octadecen-1-ol, hydrogen sulfate, sodium salt, (9Z)-, sodium oleyl alcohol sulfate, OLEYL SODIUM SULPHATE, SODIUM OLEYL SULPHATE, 9-Octadecen-1-ol, hydrogen sulfate, sodium salt, SODIUM OLEYL ALCOHOL SULPHATE, 9-Octadecen-1-ol, hydrogen sulfate, sodium salt, (Z)-, SODIUM OLEYL SULFATE [INCI]