CAS 13185-09-6 is the registry number for 1-Benzyl-3-hydroxy-1H-indazole Sodium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg.
Sodium 1-benzyl-2H-indazol-3-one (CAS 13185-09-6) is a chemical compound with the molecular formula C14H12N2NaO+ and a molecular weight of 247.25 g/mol. IUPAC name: sodium 1-benzyl-2H-indazol-3-one. InChIKey: POYTWGDRMIVNEF-UHFFFAOYSA-N.
| Molecular formula | C14H12N2NaO+ |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | sodium 1-benzyl-2H-indazol-3-one |
| InChIKey | POYTWGDRMIVNEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=O)N2.[Na+] |
Computed by PubChem (NCBI)