cas: 378-77-8 — see every product listed under this CAS number, including other names
Sodium 2,2,3,3,3-pentafluoropropanoate, 95%, 95% (CAS 378-77-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UDF-1g |
| cas | 378-77-8 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 486.80 Pln | |
| Chemat | 10g | 107.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Sodium 2,2,3,3,3-pentafluoropropanoate (CAS 378-77-8) is a chemical compound with the molecular formula C3F5NaO2 and a molecular weight of 186.01 g/mol. IUPAC name: sodium 2,2,3,3,3-pentafluoropropanoate. InChIKey: SCWLIHXXYXFUFV-UHFFFAOYSA-M.
| Molecular formula | C3F5NaO2 |
|---|---|
| Molecular weight | 186.01 g/mol |
| IUPAC name | sodium 2,2,3,3,3-pentafluoropropanoate |
| InChIKey | SCWLIHXXYXFUFV-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(F)(F)F)(F)F)[O-].[Na+] |
Computed by PubChem (NCBI)