CAS 153261-83-7 appears in our catalog under these names: Sodium 2,3-dihydro-1h-indene-5-sulfinate, 95%, 95%, SODIUM 2,3-DIHYDRO-1H-INDENE-5-SULFINATE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium 2,3-dihydro-1H-indene-5-sulfinate (CAS 153261-83-7) is a chemical compound with the molecular formula C9H9NaO2S and a molecular weight of 204.22 g/mol. IUPAC name: sodium 2,3-dihydro-1H-indene-5-sulfinate. InChIKey: RBZLUJZZFHCFOH-UHFFFAOYSA-M.
| Molecular formula | C9H9NaO2S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | sodium 2,3-dihydro-1H-indene-5-sulfinate |
| InChIKey | RBZLUJZZFHCFOH-UHFFFAOYSA-M |
| SMILES | C1CC2=C(C1)C=C(C=C2)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)