cas: 10042-71-4 — see every product listed under this CAS number, including other names
Sodium 2-(naphthalen-2-yloxy)acetate, 98%, 98% (CAS 10042-71-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112YE-5g |
| cas | 10042-71-4 |
| size | 5g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 309.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium 2-naphthalen-2-yloxyacetate (CAS 10042-71-4) is a chemical compound with the molecular formula C12H9NaO3 and a molecular weight of 224.19 g/mol. IUPAC name: sodium 2-naphthalen-2-yloxyacetate. InChIKey: OATPCHCCLFKLTN-UHFFFAOYSA-M.
| Molecular formula | C12H9NaO3 |
|---|---|
| Molecular weight | 224.19 g/mol |
| IUPAC name | sodium 2-naphthalen-2-yloxyacetate |
| InChIKey | OATPCHCCLFKLTN-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)