cas: 1421761-16-1 — see every product listed under this CAS number, including other names
Sodium 2-chloro-4,5-difluorobenzoate, 98%, 98% (CAS 1421761-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112HVV-1g |
| cas | 1421761-16-1 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 25g | 621.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium 2-chloro-4,5-difluorobenzoate (CAS 1421761-16-1) is a chemical compound with the molecular formula C7H2ClF2NaO2 and a molecular weight of 214.53 g/mol. IUPAC name: sodium 2-chloro-4,5-difluorobenzoate. InChIKey: OJWUODWXTHYICS-UHFFFAOYSA-M.
| Molecular formula | C7H2ClF2NaO2 |
|---|---|
| Molecular weight | 214.53 g/mol |
| IUPAC name | sodium 2-chloro-4,5-difluorobenzoate |
| InChIKey | OJWUODWXTHYICS-UHFFFAOYSA-M |
| SMILES | C1=C(C(=CC(=C1F)F)Cl)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)