CAS 1089719-72-1 appears in our catalog under these names: Sodium 2-chloroethanesulfonate hydrate 95%, Sodium 2-chloroethanesulfonate hydrate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 1000g, 5g, 25g, 100g, 500g, 1kg.
Sodium;2-chloroethanesulfonate;hydrate (CAS 1089719-72-1) is a chemical compound with the molecular formula C2H6ClNaO4S and a molecular weight of 184.58 g/mol. IUPAC name: sodium;2-chloroethanesulfonate;hydrate. InChIKey: OSEJMOGPHHVJJG-UHFFFAOYSA-M.
| Molecular formula | C2H6ClNaO4S |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | sodium;2-chloroethanesulfonate;hydrate |
| InChIKey | OSEJMOGPHHVJJG-UHFFFAOYSA-M |
| SMILES | C(CCl)S(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)