Sodium 2-chloroethanesulfonate hydrate, 95%
cas: 1089719-72-1 — see every product listed under this CAS number, including other names
Sodium 2-chloroethanesulfonate hydrate, 95% (CAS 1089719-72-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A889564-5g |
| cas | 1089719-72-1 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 136.75 Pln | |
| Ambeed | 100g | 153.44 Pln | |
| Ambeed | 500g | 214.62 Pln | |
| Ambeed | 1kg | 281.38 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 102.80 Pln | |
| Chemat | 500g | 235.20 Pln | |
| Chemat | 1kg | 333.20 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 136.64 Pln | |
| BLDpharm | 100g | 153.30 Pln | |
| BLDpharm | 500g | 197.73 Pln | |
| BLDpharm | 1kg | 269.93 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Sodium;2-chloroethanesulfonate;hydrate (CAS 1089719-72-1) is a chemical compound with the molecular formula C2H6ClNaO4S and a molecular weight of 184.58 g/mol. IUPAC name: sodium;2-chloroethanesulfonate;hydrate. InChIKey: OSEJMOGPHHVJJG-UHFFFAOYSA-M.
| Molecular formula | C2H6ClNaO4S |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | sodium;2-chloroethanesulfonate;hydrate |
| InChIKey | OSEJMOGPHHVJJG-UHFFFAOYSA-M |
| SMILES | C(CCl)S(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Sodium 2-chloroethanesulfonate monohydrate, Sodium 2-chloroethanesulfonate Hydrate, sodium;2-chloroethanesulfonate;hydrate, 2-Chloroethanesulfonic acid sodium salt hydrate, C2H6ClNaO4S, 2-Chloroethanesulfonic acid, sodium salt monohydrate, sodium 2-chloroethane-1-sulfonate hydrate, 15484-44-3 (anhydrous), OSEJMOGPHHVJJG-UHFFFAOYSA-M, Sodium2-chloroethanesulfonateHydrate