cas: 1208847-38-4 — see every product listed under this CAS number, including other names
Sodium 2-methyl-2-(pyrazin-2-yl)propanoate 97% (CAS 1208847-38-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1242216-100mg |
| cas | 1208847-38-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 748.62 Pln | |
| Ambeed | 250mg | 1199.19 Pln | |
| Ambeed | 1g | 3134.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1242216 |
Sodium 2-methyl-2-pyrazin-2-ylpropanoate (CAS 1208847-38-4) is a chemical compound with the molecular formula C8H9N2NaO2 and a molecular weight of 188.16 g/mol. IUPAC name: sodium 2-methyl-2-pyrazin-2-ylpropanoate. InChIKey: NDQNDQSINGBKCF-UHFFFAOYSA-M.
| Molecular formula | C8H9N2NaO2 |
|---|---|
| Molecular weight | 188.16 g/mol |
| IUPAC name | sodium 2-methyl-2-pyrazin-2-ylpropanoate |
| InChIKey | NDQNDQSINGBKCF-UHFFFAOYSA-M |
| SMILES | CC(C)(C1=NC=CN=C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)